C13H9FN2S — CID 91534267
N-(4-fluoronaphthalen-1-yl)-1,3-thiazol-2-amine (PubChem CID 91534267) has the molecular formula C13H9FN2S and a molecular weight of 244.29 g/mol. Its IUPAC name is N-(4-fluoronaphthalen-1-yl)-1,3-thiazol-2-amine.
| Compound Name | N-(4-fluoronaphthalen-1-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 91534267 |
| Molecular Formula | C13H9FN2S |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | N-(4-fluoronaphthalen-1-yl)-1,3-thiazol-2-amine |
| SMILES | Fc1ccc(Nc2nccs2)c2ccccc12 |
| InChI | InChI=1S/C13H9FN2S/c14-11-5-6-12(16-13-15-7-8-17-13)10-4-2-1-3-9(10)11/h1-8H,(H,15,16) |
| InChIKey | KRGZRTXSIZOPTJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |