C27H28F3N3O4S — CID 90742967
2-[1-(3-ethoxypropanoyl)piperidin-4-yl]-N-[2-[4-(trifluoromethoxy)phenyl]phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 90742967) has the molecular formula C27H28F3N3O4S and a molecular weight of 547.60 g/mol. Its IUPAC name is 2-[1-(3-ethoxypropanoyl)piperidin-4-yl]-N-[2-[4-(trifluoromethoxy)phenyl]phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-(3-ethoxypropanoyl)piperidin-4-yl]-N-[2-[4-(trifluoromethoxy)phenyl]phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90742967 |
| Molecular Formula | C27H28F3N3O4S |
| Molecular Weight | 547.60 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 2-[1-(3-ethoxypropanoyl)piperidin-4-yl]-N-[2-[4-(trifluoromethoxy)phenyl]phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCOCCC(=O)N1CCC(c2nc(C(=O)Nc3ccccc3-c3ccc(OC(F)(F)F)cc3)cs2)CC1 |
| InChI | InChI=1S/C27H28F3N3O4S/c1-2-36-16-13-24(34)33-14-11-19(12-15-33)26-32-23(17-38-26)25(35)31-22-6-4-3-5-21(22)18-7-9-20(10-8-18)37-27(28,29)30/h3-10,17,19H,2,11-16H2,1H3,(H,31,35) |
| InChIKey | GMKWULHOOCLDBL-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|