C25H23F3N4O3S2 — CID 59210185
2-[1-(acetylcarbamothioyl)piperidin-4-yl]-N-[2-[4-(trifluoromethoxy)phenyl]phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 59210185) has the molecular formula C25H23F3N4O3S2 and a molecular weight of 548.61 g/mol. Its IUPAC name is 2-[1-(acetylcarbamothioyl)piperidin-4-yl]-N-[2-[4-(trifluoromethoxy)phenyl]phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-(acetylcarbamothioyl)piperidin-4-yl]-N-[2-[4-(trifluoromethoxy)phenyl]phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59210185 |
| Molecular Formula | C25H23F3N4O3S2 |
| Molecular Weight | 548.61 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | 2-[1-(acetylcarbamothioyl)piperidin-4-yl]-N-[2-[4-(trifluoromethoxy)phenyl]phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(=O)NC(=S)N1CCC(c2nc(C(=O)Nc3ccccc3-c3ccc(OC(F)(F)F)cc3)cs2)CC1 |
| InChI | InChI=1S/C25H23F3N4O3S2/c1-15(33)29-24(36)32-12-10-17(11-13-32)23-31-21(14-37-23)22(34)30-20-5-3-2-4-19(20)16-6-8-18(9-7-16)35-25(26,27)28/h2-9,14,17H,10-13H2,1H3,(H,30,34)(H,29,33,36) |
| InChIKey | YBRDZLPZKIKADC-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.61 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|