About 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]pentanamide
4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]pentanamide (PubChem CID 90745625) has the molecular formula C19H22ClF2N3O3
and a molecular weight of 413.85 g/mol. Its IUPAC name is 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]pentanamide.
Molecular Properties
| Compound Name | 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]pentanamide |
| PubChem CID | 90745625 |
| Molecular Formula | C19H22ClF2N3O3 |
| Molecular Weight | 413.85 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]pentanamide |
| SMILES | CC(CCC(N)=O)c1nc(OCc2ccc(F)cc2F)c(Cl)c(=O)n1C(C)C |
| InChI | InChI=1S/C19H22ClF2N3O3/c1-10(2)25-17(11(3)4-7-15(23)26)24-18(16(20)19(25)27)28-9-12-5-6-13(21)8-14(12)22/h5-6,8,10-11H,4,7,9H2,1-3H3,(H2,23,26) |
| InChIKey | JTUXXSTXDSWIDN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.85 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]pentanamide?
The IUPAC name of 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]pentanamide (CID 90745625) is 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]pentanamide.
What is the SMILES notation for 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]pentanamide?
The canonical SMILES for 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]pentanamide is CC(CCC(N)=O)c1nc(OCc2ccc(F)cc2F)c(Cl)c(=O)n1C(C)C.
What is the InChIKey of 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]pentanamide?
The InChIKey is JTUXXSTXDSWIDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22ClF2N3O3/c1-10(2)25-17(11(3)4-7-15(23)26)24-18(16(20)19(25)27)28-9-12-5-6-13(21)8-14(12)22/h5-6,8,10-11H,4,7,9H2,1-3H3,(H2,23,26).
What are the key properties of 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]pentanamide?
4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]pentanamide has a molecular weight of 413.85 g/mol, XLogP of 3.70, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]pentanamide is sourced from PubChem (CID 90745625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).