C20H24BrF2N3O4 — CID 69352238
ethyl 4-[[5-bromo-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]amino]butanoate (PubChem CID 69352238) has the molecular formula C20H24BrF2N3O4 and a molecular weight of 488.33 g/mol. Its IUPAC name is ethyl 4-[[5-bromo-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]amino]butanoate.
| Compound Name | ethyl 4-[[5-bromo-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 69352238 |
| Molecular Formula | C20H24BrF2N3O4 |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | ethyl 4-[[5-bromo-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]amino]butanoate |
| SMILES | CCOC(=O)CCCNc1nc(OCc2ccc(F)cc2F)c(Br)c(=O)n1C(C)C |
| InChI | InChI=1S/C20H24BrF2N3O4/c1-4-29-16(27)6-5-9-24-20-25-18(17(21)19(28)26(20)12(2)3)30-11-13-7-8-14(22)10-15(13)23/h7-8,10,12H,4-6,9,11H2,1-3H3,(H,24,25) |
| InChIKey | AWUGWSCEIXWXMD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|