C18H19BrF2N2O2 — CID 69352822
5-bromo-2-but-3-enyl-6-[(2,4-difluorophenyl)methoxy]-3-propan-2-ylpyrimidin-4-one (PubChem CID 69352822) has the molecular formula C18H19BrF2N2O2 and a molecular weight of 413.26 g/mol. Its IUPAC name is 5-bromo-2-but-3-enyl-6-[(2,4-difluorophenyl)methoxy]-3-propan-2-ylpyrimidin-4-one.
| Compound Name | 5-bromo-2-but-3-enyl-6-[(2,4-difluorophenyl)methoxy]-3-propan-2-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 69352822 |
| Molecular Formula | C18H19BrF2N2O2 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 5-bromo-2-but-3-enyl-6-[(2,4-difluorophenyl)methoxy]-3-propan-2-ylpyrimidin-4-one |
| SMILES | C=CCCc1nc(OCc2ccc(F)cc2F)c(Br)c(=O)n1C(C)C |
| InChI | InChI=1S/C18H19BrF2N2O2/c1-4-5-6-15-22-17(16(19)18(24)23(15)11(2)3)25-10-12-7-8-13(20)9-14(12)21/h4,7-9,11H,1,5-6,10H2,2-3H3 |
| InChIKey | CUSOHIQMIXIGAC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|