C17H21BrF2N4O4S — CID 11547767
N-[2-[[5-bromo-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]amino]ethyl]methanesulfonamide (PubChem CID 11547767) has the molecular formula C17H21BrF2N4O4S and a molecular weight of 495.35 g/mol. Its IUPAC name is N-[2-[[5-bromo-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[5-bromo-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 11547767 |
| Molecular Formula | C17H21BrF2N4O4S |
| Molecular Weight | 495.35 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | N-[2-[[5-bromo-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]amino]ethyl]methanesulfonamide |
| SMILES | CC(C)n1c(NCCNS(C)(=O)=O)nc(OCc2ccc(F)cc2F)c(Br)c1=O |
| InChI | InChI=1S/C17H21BrF2N4O4S/c1-10(2)24-16(25)14(18)15(23-17(24)21-6-7-22-29(3,26)27)28-9-11-4-5-12(19)8-13(11)20/h4-5,8,10,22H,6-7,9H2,1-3H3,(H,21,23) |
| InChIKey | HLRYPLKYKRLCJO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|