About CID 90747113
CID 90747113 (PubChem CID 90747113) has the molecular formula C14H17BBrN2O+
and a molecular weight of 320.02 g/mol.
Molecular Properties
| Compound Name | CID 90747113 |
| PubChem CID | 90747113 |
| Molecular Formula | C14H17BBrN2O+ |
| Molecular Weight | 320.02 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | — |
| SMILES | [B][N+]12CC3CC(C1)C(Oc1ccc(Br)nc1)C(C3)C2 |
| InChI | InChI=1S/C14H17BBrN2O/c15-18-6-9-3-10(7-18)14(11(4-9)8-18)19-12-1-2-13(16)17-5-12/h1-2,5,9-11,14H,3-4,6-8H2/q+1 |
| InChIKey | OKTQZJOAONLSTL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.02 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 90747113 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90747113?
The IUPAC name of CID 90747113 (CID 90747113) is not available.
What is the SMILES notation for CID 90747113?
The canonical SMILES for CID 90747113 is [B][N+]12CC3CC(C1)C(Oc1ccc(Br)nc1)C(C3)C2.
What is the InChIKey of CID 90747113?
The InChIKey is OKTQZJOAONLSTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BBrN2O/c15-18-6-9-3-10(7-18)14(11(4-9)8-18)19-12-1-2-13(16)17-5-12/h1-2,5,9-11,14H,3-4,6-8H2/q+1.
What are the key properties of CID 90747113?
CID 90747113 has a molecular weight of 320.02 g/mol, XLogP of 2.16, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90747113 is sourced from PubChem (CID 90747113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).