C20H30N8O3 — CID 90747238
N-[4-[6-amino-2-(cyclohexylmethyldiazenyl)purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide (PubChem CID 90747238) has the molecular formula C20H30N8O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-[4-[6-amino-2-(cyclohexylmethyldiazenyl)purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide.
| Compound Name | N-[4-[6-amino-2-(cyclohexylmethyldiazenyl)purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
|---|---|
| PubChem CID | 90747238 |
| Molecular Formula | C20H30N8O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | N-[4-[6-amino-2-(cyclohexylmethyldiazenyl)purin-9-yl]-2,3-dihydroxycyclopentyl]propanamide |
| SMILES | CCC(=O)NC1CC(n2cnc3c(N)nc(/N=N/CC4CCCCC4)nc32)C(O)C1O |
| InChI | InChI=1S/C20H30N8O3/c1-2-14(29)24-12-8-13(17(31)16(12)30)28-10-22-15-18(21)25-20(26-19(15)28)27-23-9-11-6-4-3-5-7-11/h10-13,16-17,30-31H,2-9H2,1H3,(H,24,29)(H2,21,25,26)/b27-23+ |
| InChIKey | CKBJOMUISDPQTM-SLEBQGDGSA-N |
| XLogP | 1.63 |
| TPSA | 163.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|