C19H14F3NO — CID 90747358
3-(2,3-dihydro-1H-inden-1-yl)-2-(trifluoromethyl)-1H-quinolin-4-one (PubChem CID 90747358) has the molecular formula C19H14F3NO and a molecular weight of 329.32 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-1-yl)-2-(trifluoromethyl)-1H-quinolin-4-one.
| Compound Name | 3-(2,3-dihydro-1H-inden-1-yl)-2-(trifluoromethyl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 90747358 |
| Molecular Formula | C19H14F3NO |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-1-yl)-2-(trifluoromethyl)-1H-quinolin-4-one |
| SMILES | O=c1c(C2CCc3ccccc32)c(C(F)(F)F)[nH]c2ccccc12 |
| InChI | InChI=1S/C19H14F3NO/c20-19(21,22)18-16(13-10-9-11-5-1-2-6-12(11)13)17(24)14-7-3-4-8-15(14)23-18/h1-8,13H,9-10H2,(H,23,24) |
| InChIKey | HFPLBENOYUCEGX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |