C11H12N2O7S — CID 90748032
[4-amino-1-(hydroxyamino)-1,4-dioxobutan-2-yl]sulfonyl benzoate (PubChem CID 90748032) has the molecular formula C11H12N2O7S and a molecular weight of 316.29 g/mol. Its IUPAC name is [4-amino-1-(hydroxyamino)-1,4-dioxobutan-2-yl]sulfonyl benzoate.
| Compound Name | [4-amino-1-(hydroxyamino)-1,4-dioxobutan-2-yl]sulfonyl benzoate |
|---|---|
| PubChem CID | 90748032 |
| Molecular Formula | C11H12N2O7S |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | [4-amino-1-(hydroxyamino)-1,4-dioxobutan-2-yl]sulfonyl benzoate |
| SMILES | NC(=O)CC(C(=O)NO)S(=O)(=O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H12N2O7S/c12-9(14)6-8(10(15)13-17)21(18,19)20-11(16)7-4-2-1-3-5-7/h1-5,8,17H,6H2,(H2,12,14)(H,13,15) |
| InChIKey | TYAJHYZAGUABKJ-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 152.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|