C27H50O8 — CID 90749274
(3R,4S,5R,6R)-2-(1,2-dihydroxyhenicosa-12,15-dien-3-yloxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 90749274) has the molecular formula C27H50O8 and a molecular weight of 502.69 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-(1,2-dihydroxyhenicosa-12,15-dien-3-yloxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4S,5R,6R)-2-(1,2-dihydroxyhenicosa-12,15-dien-3-yloxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 90749274 |
| Molecular Formula | C27H50O8 |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.35 |
| IUPAC Name | (3R,4S,5R,6R)-2-(1,2-dihydroxyhenicosa-12,15-dien-3-yloxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(OC1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)C(O)CO |
| InChI | InChI=1S/C27H50O8/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(21(30)19-28)34-27-26(33)25(32)24(31)23(20-29)35-27/h6-7,9-10,21-33H,2-5,8,11-20H2,1H3/t21?,22?,23-,24+,25+,26-,27?/m1/s1 |
| InChIKey | GKDGMGXBEUPZSD-WBZZVDTASA-N |
| XLogP | 2.73 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|