C43H72O10 — CID 24899085
[(7Z,10Z)-hexadeca-7,10-dienoyl] (9Z,12Z,15Z)-2-propan-2-yl-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctadeca-9,12,15-trieneperoxoate (PubChem CID 24899085) has the molecular formula C43H72O10 and a molecular weight of 749.04 g/mol. Its IUPAC name is [(7Z,10Z)-hexadeca-7,10-dienoyl] (9Z,12Z,15Z)-2-propan-2-yl-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctadeca-9,12,15-trieneperoxoate.
| Compound Name | [(7Z,10Z)-hexadeca-7,10-dienoyl] (9Z,12Z,15Z)-2-propan-2-yl-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctadeca-9,12,15-trieneperoxoate |
|---|---|
| PubChem CID | 24899085 |
| Molecular Formula | C43H72O10 |
| Molecular Weight | 749.04 g/mol |
| Exact Mass | 748.51 |
| IUPAC Name | [(7Z,10Z)-hexadeca-7,10-dienoyl] (9Z,12Z,15Z)-2-propan-2-yl-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctadeca-9,12,15-trieneperoxoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)C(C(=O)OOC(=O)CCCCC/C=C\C/C=C\CCCCC)C(C)C |
| InChI | InChI=1S/C43H72O10/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35(50-43-41(48)40(47)39(46)36(33-44)51-43)38(34(3)4)42(49)53-52-37(45)32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h7,9,13-16,19-22,34-36,38-41,43-44,46-48H,5-6,8,10-12,17-18,23-33H2,1-4H3/b9-7-,15-13-,16-14-,21-19-,22-20-/t35?,36-,38?,39+,40+,41-,43-/m1/s1 |
| InChIKey | AFWPCNVFIYSWIV-BFDHAUOTSA-N |
| XLogP | 8.29 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.04 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|