C13H13NO3 — CID 90751053
4-(3,5-dimethoxyphenoxy)pyridine (PubChem CID 90751053) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 4-(3,5-dimethoxyphenoxy)pyridine.
| Compound Name | 4-(3,5-dimethoxyphenoxy)pyridine |
|---|---|
| PubChem CID | 90751053 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 4-(3,5-dimethoxyphenoxy)pyridine |
| SMILES | COc1cc(OC)cc(Oc2ccncc2)c1 |
| InChI | InChI=1S/C13H13NO3/c1-15-11-7-12(16-2)9-13(8-11)17-10-3-5-14-6-4-10/h3-9H,1-2H3 |
| InChIKey | DPWPQDNBZODKMF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |