C9H12F3NO2 — CID 90753169
N-(3,6-dihydro-2H-pyran-2-yl)-4,4,4-trifluorobutanamide (PubChem CID 90753169) has the molecular formula C9H12F3NO2 and a molecular weight of 223.19 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-2-yl)-4,4,4-trifluorobutanamide.
| Compound Name | N-(3,6-dihydro-2H-pyran-2-yl)-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 90753169 |
| Molecular Formula | C9H12F3NO2 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-2-yl)-4,4,4-trifluorobutanamide |
| SMILES | O=C(CCC(F)(F)F)NC1CC=CCO1 |
| InChI | InChI=1S/C9H12F3NO2/c10-9(11,12)5-4-7(14)13-8-3-1-2-6-15-8/h1-2,8H,3-6H2,(H,13,14) |
| InChIKey | HIBHIFBZWLMVKY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|