C8H11F2NO2 — CID 130668383
N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,2-difluoroacetamide (PubChem CID 130668383) has the molecular formula C8H11F2NO2 and a molecular weight of 191.18 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,2-difluoroacetamide.
| Compound Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 130668383 |
| Molecular Formula | C8H11F2NO2 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-5-ylmethyl)-2,2-difluoroacetamide |
| SMILES | O=C(NCC1=CCCOC1)C(F)F |
| InChI | InChI=1S/C8H11F2NO2/c9-7(10)8(12)11-4-6-2-1-3-13-5-6/h2,7H,1,3-5H2,(H,11,12) |
| InChIKey | OZXYOABKUHJQJQ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|