C9H12N2O2 — CID 130658625
2-cyano-N-(3,6-dihydro-2H-pyran-5-ylmethyl)acetamide (PubChem CID 130658625) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-cyano-N-(3,6-dihydro-2H-pyran-5-ylmethyl)acetamide.
| Compound Name | 2-cyano-N-(3,6-dihydro-2H-pyran-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 130658625 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-cyano-N-(3,6-dihydro-2H-pyran-5-ylmethyl)acetamide |
| SMILES | N#CCC(=O)NCC1=CCCOC1 |
| InChI | InChI=1S/C9H12N2O2/c10-4-3-9(12)11-6-8-2-1-5-13-7-8/h2H,1,3,5-7H2,(H,11,12) |
| InChIKey | CDUGHSYKAMSMAX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|