C12H18N2O2 — CID 115741938
3-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N-prop-2-ynylpropanamide (PubChem CID 115741938) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N-prop-2-ynylpropanamide.
| Compound Name | 3-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 115741938 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 3-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)CCNCC1=CCCOC1 |
| InChI | InChI=1S/C12H18N2O2/c1-2-6-14-12(15)5-7-13-9-11-4-3-8-16-10-11/h1,4,13H,3,5-10H2,(H,14,15) |
| InChIKey | QUEYANORUDANTK-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|