C12H22N2O2 — CID 115749006
3-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N,2,2-trimethylpropanamide (PubChem CID 115749006) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N,2,2-trimethylpropanamide.
| Compound Name | 3-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 115749006 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 3-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNCC1=CCCOC1 |
| InChI | InChI=1S/C12H22N2O2/c1-12(2,11(15)13-3)9-14-7-10-5-4-6-16-8-10/h5,14H,4,6-9H2,1-3H3,(H,13,15) |
| InChIKey | MYGFVHYRZZEQAY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|