C12H22N2O2 — CID 115741887
3-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N-propylpropanamide (PubChem CID 115741887) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N-propylpropanamide.
| Compound Name | 3-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N-propylpropanamide |
|---|---|
| PubChem CID | 115741887 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 3-(3,6-dihydro-2H-pyran-5-ylmethylamino)-N-propylpropanamide |
| SMILES | CCCNC(=O)CCNCC1=CCCOC1 |
| InChI | InChI=1S/C12H22N2O2/c1-2-6-14-12(15)5-7-13-9-11-4-3-8-16-10-11/h4,13H,2-3,5-10H2,1H3,(H,14,15) |
| InChIKey | CXRYKDSTVCMXQP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|