C8H13NO2 — CID 143931906
5-(ethoxymethyl)-2,3-dihydro-1H-pyridin-6-one (PubChem CID 143931906) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 5-(ethoxymethyl)-2,3-dihydro-1H-pyridin-6-one.
| Compound Name | 5-(ethoxymethyl)-2,3-dihydro-1H-pyridin-6-one |
|---|---|
| PubChem CID | 143931906 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 5-(ethoxymethyl)-2,3-dihydro-1H-pyridin-6-one |
| SMILES | CCOCC1=CCCNC1=O |
| InChI | InChI=1S/C8H13NO2/c1-2-11-6-7-4-3-5-9-8(7)10/h4H,2-3,5-6H2,1H3,(H,9,10) |
| InChIKey | NUESCQCPVLBNKX-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |