About 5-(iodomethoxymethyl)-2,3-dihydro-1H-pyridin-6-one
5-(iodomethoxymethyl)-2,3-dihydro-1H-pyridin-6-one (PubChem CID 163791572) has the molecular formula C7H10INO2
and a molecular weight of 267.07 g/mol. Its IUPAC name is 5-(iodomethoxymethyl)-2,3-dihydro-1H-pyridin-6-one.
Molecular Properties
| Compound Name | 5-(iodomethoxymethyl)-2,3-dihydro-1H-pyridin-6-one |
| PubChem CID | 163791572 |
| Molecular Formula | C7H10INO2 |
| Molecular Weight | 267.07 g/mol |
| Exact Mass | 266.98 |
| IUPAC Name | 5-(iodomethoxymethyl)-2,3-dihydro-1H-pyridin-6-one |
| SMILES | O=C1NCCC=C1COCI |
| InChI | InChI=1S/C7H10INO2/c8-5-11-4-6-2-1-3-9-7(6)10/h2H,1,3-5H2,(H,9,10) |
| InChIKey | MXFRLKWVXXFHDI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.07 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(iodomethoxymethyl)-2,3-dihydro-1H-pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(iodomethoxymethyl)-2,3-dihydro-1H-pyridin-6-one?
The IUPAC name of 5-(iodomethoxymethyl)-2,3-dihydro-1H-pyridin-6-one (CID 163791572) is 5-(iodomethoxymethyl)-2,3-dihydro-1H-pyridin-6-one.
What is the SMILES notation for 5-(iodomethoxymethyl)-2,3-dihydro-1H-pyridin-6-one?
The canonical SMILES for 5-(iodomethoxymethyl)-2,3-dihydro-1H-pyridin-6-one is O=C1NCCC=C1COCI.
What is the InChIKey of 5-(iodomethoxymethyl)-2,3-dihydro-1H-pyridin-6-one?
The InChIKey is MXFRLKWVXXFHDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10INO2/c8-5-11-4-6-2-1-3-9-7(6)10/h2H,1,3-5H2,(H,9,10).
What are the key properties of 5-(iodomethoxymethyl)-2,3-dihydro-1H-pyridin-6-one?
5-(iodomethoxymethyl)-2,3-dihydro-1H-pyridin-6-one has a molecular weight of 267.07 g/mol, XLogP of 0.84, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(iodomethoxymethyl)-2,3-dihydro-1H-pyridin-6-one is sourced from PubChem (CID 163791572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).