C10H14N2O2 — CID 130783814
2-cyano-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide (PubChem CID 130783814) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-cyano-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide.
| Compound Name | 2-cyano-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide |
|---|---|
| PubChem CID | 130783814 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-cyano-N-(3,6-dihydro-2H-pyran-5-ylmethyl)propanamide |
| SMILES | CC(C#N)C(=O)NCC1=CCCOC1 |
| InChI | InChI=1S/C10H14N2O2/c1-8(5-11)10(13)12-6-9-3-2-4-14-7-9/h3,8H,2,4,6-7H2,1H3,(H,12,13) |
| InChIKey | WTFHUTZDDLAYHW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|