C25H28N4O6 — CID 90754256
tert-butyl 2,4-dioxo-3-[[4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]-1,4a,5,7,8,8a-hexahydro-1,6-naphthyridine-6-carboxylate (PubChem CID 90754256) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is tert-butyl 2,4-dioxo-3-[[4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]-1,4a,5,7,8,8a-hexahydro-1,6-naphthyridine-6-carboxylate.
| Compound Name | tert-butyl 2,4-dioxo-3-[[4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]-1,4a,5,7,8,8a-hexahydro-1,6-naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 90754256 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | tert-butyl 2,4-dioxo-3-[[4-(2-oxo-1-pyridinyl)phenyl]carbamoyl]-1,4a,5,7,8,8a-hexahydro-1,6-naphthyridine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2NC(=O)C(C(=O)Nc3ccc(-n4ccccc4=O)cc3)C(=O)C2C1 |
| InChI | InChI=1S/C25H28N4O6/c1-25(2,3)35-24(34)28-13-11-18-17(14-28)21(31)20(23(33)27-18)22(32)26-15-7-9-16(10-8-15)29-12-5-4-6-19(29)30/h4-10,12,17-18,20H,11,13-14H2,1-3H3,(H,26,32)(H,27,33) |
| InChIKey | WCGYQXZQNYRKCD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|