C8H15N5 — CID 90754338
1-(2H-triazol-4-ylmethyl)-1,3-diazepane (PubChem CID 90754338) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 1-(2H-triazol-4-ylmethyl)-1,3-diazepane.
| Compound Name | 1-(2H-triazol-4-ylmethyl)-1,3-diazepane |
|---|---|
| PubChem CID | 90754338 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 1-(2H-triazol-4-ylmethyl)-1,3-diazepane |
| SMILES | c1n[nH]nc1CN1CCCCNC1 |
| InChI | InChI=1S/C8H15N5/c1-2-4-13(7-9-3-1)6-8-5-10-12-11-8/h5,9H,1-4,6-7H2,(H,10,11,12) |
| InChIKey | RGTPFGNGWZOACU-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |