C41H55N11O — CID 123732651
N,N-dimethyl-2-[4-[1-phenyl-2-[4-[4-[[1-(2H-triazol-4-ylmethyl)-1,3,7,10-tetrazacyclotridec-7-yl]methyl]triazol-1-yl]phenyl]but-1-enyl]phenoxy]ethanamine (PubChem CID 123732651) has the molecular formula C41H55N11O and a molecular weight of 717.97 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-[1-phenyl-2-[4-[4-[[1-(2H-triazol-4-ylmethyl)-1,3,7,10-tetrazacyclotridec-7-yl]methyl]triazol-1-yl]phenyl]but-1-enyl]phenoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[4-[1-phenyl-2-[4-[4-[[1-(2H-triazol-4-ylmethyl)-1,3,7,10-tetrazacyclotridec-7-yl]methyl]triazol-1-yl]phenyl]but-1-enyl]phenoxy]ethanamine |
|---|---|
| PubChem CID | 123732651 |
| Molecular Formula | C41H55N11O |
| Molecular Weight | 717.97 g/mol |
| Exact Mass | 717.46 |
| IUPAC Name | N,N-dimethyl-2-[4-[1-phenyl-2-[4-[4-[[1-(2H-triazol-4-ylmethyl)-1,3,7,10-tetrazacyclotridec-7-yl]methyl]triazol-1-yl]phenyl]but-1-enyl]phenoxy]ethanamine |
| SMILES | CCC(=C(c1ccccc1)c1ccc(OCCN(C)C)cc1)c1ccc(-n2cc(CN3CCCNCN(Cc4cn[nH]n4)CCCNCC3)nn2)cc1 |
| InChI | InChI=1S/C41H55N11O/c1-4-40(41(34-10-6-5-7-11-34)35-14-18-39(19-15-35)53-27-26-49(2)3)33-12-16-38(17-13-33)52-31-37(46-48-52)30-50-23-9-21-43-32-51(24-8-20-42-22-25-50)29-36-28-44-47-45-36/h5-7,10-19,28,31,42-43H,4,8-9,20-27,29-30,32H2,1-3H3,(H,44,45,47) |
| InChIKey | BOZHZMKUYHVOER-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.97 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|