C9H15NO3 — CID 90755093
3,4-diethyl-1-methoxypyrrole-2,5-diol (PubChem CID 90755093) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 3,4-diethyl-1-methoxypyrrole-2,5-diol.
| Compound Name | 3,4-diethyl-1-methoxypyrrole-2,5-diol |
|---|---|
| PubChem CID | 90755093 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 3,4-diethyl-1-methoxypyrrole-2,5-diol |
| SMILES | CCc1c(CC)c(O)n(OC)c1O |
| InChI | InChI=1S/C9H15NO3/c1-4-6-7(5-2)9(12)10(13-3)8(6)11/h11-12H,4-5H2,1-3H3 |
| InChIKey | QFJCOVPEXNSERP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |