C12H14BrN3O6 — CID 90755571
3-[4-amino-1-[(2S,3R,4S)-3-bromo-4-hydroxy-2-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]prop-2-enoic acid (PubChem CID 90755571) has the molecular formula C12H14BrN3O6 and a molecular weight of 376.16 g/mol. Its IUPAC name is 3-[4-amino-1-[(2S,3R,4S)-3-bromo-4-hydroxy-2-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]prop-2-enoic acid.
| Compound Name | 3-[4-amino-1-[(2S,3R,4S)-3-bromo-4-hydroxy-2-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90755571 |
| Molecular Formula | C12H14BrN3O6 |
| Molecular Weight | 376.16 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 3-[4-amino-1-[(2S,3R,4S)-3-bromo-4-hydroxy-2-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]prop-2-enoic acid |
| SMILES | Nc1nc(=O)n([C@@]2(CO)OC[C@H](O)[C@H]2Br)cc1C=CC(=O)O |
| InChI | InChI=1S/C12H14BrN3O6/c13-9-7(18)4-22-12(9,5-17)16-3-6(1-2-8(19)20)10(14)15-11(16)21/h1-3,7,9,17-18H,4-5H2,(H,19,20)(H2,14,15,21)/t7-,9+,12-/m0/s1 |
| InChIKey | MQHRKJJHEUMFRO-VMAXQDLPSA-N |
| XLogP | -1.28 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.16 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|