C11H13BrClN3O4 — CID 91330161
4-amino-1-[(2S,3R,4S)-3-bromo-4-hydroxy-2-(hydroxymethyl)oxolan-2-yl]-5-(2-chloroethenyl)pyrimidin-2-one (PubChem CID 91330161) has the molecular formula C11H13BrClN3O4 and a molecular weight of 366.60 g/mol. Its IUPAC name is 4-amino-1-[(2S,3R,4S)-3-bromo-4-hydroxy-2-(hydroxymethyl)oxolan-2-yl]-5-(2-chloroethenyl)pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2S,3R,4S)-3-bromo-4-hydroxy-2-(hydroxymethyl)oxolan-2-yl]-5-(2-chloroethenyl)pyrimidin-2-one |
|---|---|
| PubChem CID | 91330161 |
| Molecular Formula | C11H13BrClN3O4 |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 4-amino-1-[(2S,3R,4S)-3-bromo-4-hydroxy-2-(hydroxymethyl)oxolan-2-yl]-5-(2-chloroethenyl)pyrimidin-2-one |
| SMILES | Nc1nc(=O)n([C@@]2(CO)OC[C@H](O)[C@H]2Br)cc1C=CCl |
| InChI | InChI=1S/C11H13BrClN3O4/c12-8-7(18)4-20-11(8,5-17)16-3-6(1-2-13)9(14)15-10(16)19/h1-3,7-8,17-18H,4-5H2,(H2,14,15,19)/t7-,8+,11-/m0/s1 |
| InChIKey | KVXABIMDDUDYHF-RNSXUZJQSA-N |
| XLogP | -0.17 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|