C16H14ClNO2S — CID 90755808
2-(4-chlorobenzenecarboximidoyl)-3,3-dihydroxy-1-phenylpropane-1-thione (PubChem CID 90755808) has the molecular formula C16H14ClNO2S and a molecular weight of 319.81 g/mol. Its IUPAC name is 2-(4-chlorobenzenecarboximidoyl)-3,3-dihydroxy-1-phenylpropane-1-thione.
| Compound Name | 2-(4-chlorobenzenecarboximidoyl)-3,3-dihydroxy-1-phenylpropane-1-thione |
|---|---|
| PubChem CID | 90755808 |
| Molecular Formula | C16H14ClNO2S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-(4-chlorobenzenecarboximidoyl)-3,3-dihydroxy-1-phenylpropane-1-thione |
| SMILES | [H]/N=C(\c1ccc(Cl)cc1)C(C(=S)c1ccccc1)C(O)O |
| InChI | InChI=1S/C16H14ClNO2S/c17-12-8-6-10(7-9-12)14(18)13(16(19)20)15(21)11-4-2-1-3-5-11/h1-9,13,16,18-20H/b18-14+ |
| InChIKey | AAEKOUOWSLAOAM-NBVRZTHBSA-N |
| XLogP | 3.05 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|