C19H29NO — CID 174886504
3-(benzenecarboximidoyl)-2,7,8-trimethylnonan-4-one (PubChem CID 174886504) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 3-(benzenecarboximidoyl)-2,7,8-trimethylnonan-4-one.
| Compound Name | 3-(benzenecarboximidoyl)-2,7,8-trimethylnonan-4-one |
|---|---|
| PubChem CID | 174886504 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 3-(benzenecarboximidoyl)-2,7,8-trimethylnonan-4-one |
| SMILES | [H]/N=C(\c1ccccc1)C(C(=O)CCC(C)C(C)C)C(C)C |
| InChI | InChI=1S/C19H29NO/c1-13(2)15(5)11-12-17(21)18(14(3)4)19(20)16-9-7-6-8-10-16/h6-10,13-15,18,20H,11-12H2,1-5H3/b20-19+ |
| InChIKey | AEZOEVIXZZIVGQ-FMQUCBEESA-N |
| XLogP | 4.97 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|