About 5-hydroxy-1,1-diisocyanatopentan-2-one
5-hydroxy-1,1-diisocyanatopentan-2-one (PubChem CID 90756437) has the molecular formula C7H8N2O4
and a molecular weight of 184.15 g/mol. Its IUPAC name is 5-hydroxy-1,1-diisocyanatopentan-2-one.
Molecular Properties
| Compound Name | 5-hydroxy-1,1-diisocyanatopentan-2-one |
| PubChem CID | 90756437 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 5-hydroxy-1,1-diisocyanatopentan-2-one |
| SMILES | O=C=NC(N=C=O)C(=O)CCCO |
| InChI | InChI=1S/C7H8N2O4/c10-3-1-2-6(13)7(8-4-11)9-5-12/h7,10H,1-3H2 |
| InChIKey | OIDAWEAZZCOYIV-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-1,1-diisocyanatopentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-1,1-diisocyanatopentan-2-one?
The IUPAC name of 5-hydroxy-1,1-diisocyanatopentan-2-one (CID 90756437) is 5-hydroxy-1,1-diisocyanatopentan-2-one.
What is the SMILES notation for 5-hydroxy-1,1-diisocyanatopentan-2-one?
The canonical SMILES for 5-hydroxy-1,1-diisocyanatopentan-2-one is O=C=NC(N=C=O)C(=O)CCCO.
What is the InChIKey of 5-hydroxy-1,1-diisocyanatopentan-2-one?
The InChIKey is OIDAWEAZZCOYIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4/c10-3-1-2-6(13)7(8-4-11)9-5-12/h7,10H,1-3H2.
What are the key properties of 5-hydroxy-1,1-diisocyanatopentan-2-one?
5-hydroxy-1,1-diisocyanatopentan-2-one has a molecular weight of 184.15 g/mol, XLogP of -0.67, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-1,1-diisocyanatopentan-2-one is sourced from PubChem (CID 90756437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).