C12H24O2 — CID 129266454
1-hydroxy-5,7,8-trimethylnonan-4-one (PubChem CID 129266454) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is 1-hydroxy-5,7,8-trimethylnonan-4-one.
| Compound Name | 1-hydroxy-5,7,8-trimethylnonan-4-one |
|---|---|
| PubChem CID | 129266454 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 1-hydroxy-5,7,8-trimethylnonan-4-one |
| SMILES | CC(CC(C)C(C)C)C(=O)CCCO |
| InChI | InChI=1S/C12H24O2/c1-9(2)10(3)8-11(4)12(14)6-5-7-13/h9-11,13H,5-8H2,1-4H3 |
| InChIKey | ZYQVAICXESGMME-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |