C12H17NO4 — CID 90756814
(2,5-dihydroxypyrrol-1-yl) 5-methyl-4-methylidenehexanoate (PubChem CID 90756814) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 5-methyl-4-methylidenehexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 5-methyl-4-methylidenehexanoate |
|---|---|
| PubChem CID | 90756814 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 5-methyl-4-methylidenehexanoate |
| SMILES | C=C(CCC(=O)On1c(O)ccc1O)C(C)C |
| InChI | InChI=1S/C12H17NO4/c1-8(2)9(3)4-7-12(16)17-13-10(14)5-6-11(13)15/h5-6,8,14-15H,3-4,7H2,1-2H3 |
| InChIKey | MZOLNDPOIAUFHG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|