C26H31N5O2 — CID 90759394
2-(2-methoxyethylamino)-4-[[(4-methylphenyl)-phenylmethyl]amino]-6-propan-2-ylpyrrolo[3,4-d]pyrimidin-7-ol (PubChem CID 90759394) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-4-[[(4-methylphenyl)-phenylmethyl]amino]-6-propan-2-ylpyrrolo[3,4-d]pyrimidin-7-ol.
| Compound Name | 2-(2-methoxyethylamino)-4-[[(4-methylphenyl)-phenylmethyl]amino]-6-propan-2-ylpyrrolo[3,4-d]pyrimidin-7-ol |
|---|---|
| PubChem CID | 90759394 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 2-(2-methoxyethylamino)-4-[[(4-methylphenyl)-phenylmethyl]amino]-6-propan-2-ylpyrrolo[3,4-d]pyrimidin-7-ol |
| SMILES | COCCNc1nc(NC(c2ccccc2)c2ccc(C)cc2)c2cn(C(C)C)c(O)c2n1 |
| InChI | InChI=1S/C26H31N5O2/c1-17(2)31-16-21-23(25(31)32)29-26(27-14-15-33-4)30-24(21)28-22(19-8-6-5-7-9-19)20-12-10-18(3)11-13-20/h5-13,16-17,22,32H,14-15H2,1-4H3,(H2,27,28,29,30) |
| InChIKey | JWKYWBJXJPLJTL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|