C24H28N6O — CID 142715142
4-[[1-benzyl-4-(1-phenylethylamino)pyrazolo[3,4-d]pyrimidin-6-yl]amino]butan-1-ol (PubChem CID 142715142) has the molecular formula C24H28N6O and a molecular weight of 416.53 g/mol. Its IUPAC name is 4-[[1-benzyl-4-(1-phenylethylamino)pyrazolo[3,4-d]pyrimidin-6-yl]amino]butan-1-ol.
| Compound Name | 4-[[1-benzyl-4-(1-phenylethylamino)pyrazolo[3,4-d]pyrimidin-6-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 142715142 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 4-[[1-benzyl-4-(1-phenylethylamino)pyrazolo[3,4-d]pyrimidin-6-yl]amino]butan-1-ol |
| SMILES | CC(Nc1nc(NCCCCO)nc2c1cnn2Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H28N6O/c1-18(20-12-6-3-7-13-20)27-22-21-16-26-30(17-19-10-4-2-5-11-19)23(21)29-24(28-22)25-14-8-9-15-31/h2-7,10-13,16,18,31H,8-9,14-15,17H2,1H3,(H2,25,27,28,29) |
| InChIKey | XMLFKYCKIVHHNM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|