C24H41N7O3 — CID 90759613
2-[[(carbamoylamino)-morpholin-4-ylmethylidene]amino]-N-[3-cyano-1-(cyclohexylmethyl)pyrrolidin-3-yl]-4-methylpentanamide (PubChem CID 90759613) has the molecular formula C24H41N7O3 and a molecular weight of 475.64 g/mol. Its IUPAC name is 2-[[(carbamoylamino)-morpholin-4-ylmethylidene]amino]-N-[3-cyano-1-(cyclohexylmethyl)pyrrolidin-3-yl]-4-methylpentanamide.
| Compound Name | 2-[[(carbamoylamino)-morpholin-4-ylmethylidene]amino]-N-[3-cyano-1-(cyclohexylmethyl)pyrrolidin-3-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 90759613 |
| Molecular Formula | C24H41N7O3 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.33 |
| IUPAC Name | 2-[[(carbamoylamino)-morpholin-4-ylmethylidene]amino]-N-[3-cyano-1-(cyclohexylmethyl)pyrrolidin-3-yl]-4-methylpentanamide |
| SMILES | CC(C)CC(/N=C(\NC(N)=O)N1CCOCC1)C(=O)NC1(C#N)CCN(CC2CCCCC2)C1 |
| InChI | InChI=1S/C24H41N7O3/c1-18(2)14-20(27-23(28-22(26)33)31-10-12-34-13-11-31)21(32)29-24(16-25)8-9-30(17-24)15-19-6-4-3-5-7-19/h18-20H,3-15,17H2,1-2H3,(H,29,32)(H3,26,27,28,33) |
| InChIKey | OYPZBRUSVYVTLR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|