C21H36O2 — CID 90759801
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-7-methyldecane-1,5-dione (PubChem CID 90759801) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-7-methyldecane-1,5-dione.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-7-methyldecane-1,5-dione |
|---|---|
| PubChem CID | 90759801 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-7-methyldecane-1,5-dione |
| SMILES | CCCC(C)CC(=O)CCCC(=O)C1CCCC2CCCCC21 |
| InChI | InChI=1S/C21H36O2/c1-3-8-16(2)15-18(22)11-7-14-21(23)20-13-6-10-17-9-4-5-12-19(17)20/h16-17,19-20H,3-15H2,1-2H3 |
| InChIKey | DHEMUUOHYKXITM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |