C26H40O2 — CID 90871527
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-8-cyclohexyl-6-methylidenenon-8-ene-1,7-dione (PubChem CID 90871527) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-8-cyclohexyl-6-methylidenenon-8-ene-1,7-dione.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-8-cyclohexyl-6-methylidenenon-8-ene-1,7-dione |
|---|---|
| PubChem CID | 90871527 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-8-cyclohexyl-6-methylidenenon-8-ene-1,7-dione |
| SMILES | C=C(CCCCC(=O)C1CCCC2CCCCC21)C(=O)C(=C)C1CCCCC1 |
| InChI | InChI=1S/C26H40O2/c1-19(26(28)20(2)21-12-4-3-5-13-21)11-6-9-18-25(27)24-17-10-15-22-14-7-8-16-23(22)24/h21-24H,1-18H2 |
| InChIKey | BFGOQAKRAMPCEQ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|