C10H18FNO — CID 90764428
1-(4-fluorohexa-2,4-dien-2-yloxy)butan-2-amine (PubChem CID 90764428) has the molecular formula C10H18FNO and a molecular weight of 187.26 g/mol. Its IUPAC name is 1-(4-fluorohexa-2,4-dien-2-yloxy)butan-2-amine.
| Compound Name | 1-(4-fluorohexa-2,4-dien-2-yloxy)butan-2-amine |
|---|---|
| PubChem CID | 90764428 |
| Molecular Formula | C10H18FNO |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1-(4-fluorohexa-2,4-dien-2-yloxy)butan-2-amine |
| SMILES | CC=C(F)C=C(C)OCC(N)CC |
| InChI | InChI=1S/C10H18FNO/c1-4-9(11)6-8(3)13-7-10(12)5-2/h4,6,10H,5,7,12H2,1-3H3 |
| InChIKey | ALGPGQGNLWNNMH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|