C7H19ClN2O — CID 88777297
2-aminobutyl hypochlorite;N,N-dimethylmethanamine (PubChem CID 88777297) has the molecular formula C7H19ClN2O and a molecular weight of 182.69 g/mol. Its IUPAC name is 2-aminobutyl hypochlorite;N,N-dimethylmethanamine.
| Compound Name | 2-aminobutyl hypochlorite;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 88777297 |
| Molecular Formula | C7H19ClN2O |
| Molecular Weight | 182.69 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2-aminobutyl hypochlorite;N,N-dimethylmethanamine |
| SMILES | CCC(N)COCl.CN(C)C |
| InChI | InChI=1S/C4H10ClNO.C3H9N/c1-2-4(6)3-7-5;1-4(2)3/h4H,2-3,6H2,1H3;1-3H3 |
| InChIKey | SUMBFYYRHHKXEB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.69 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |