C21H24N2O5 — CID 9076521
2-[[2-(4-benzoylphenoxy)acetyl]-methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 9076521) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-[[2-(4-benzoylphenoxy)acetyl]-methylamino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[2-(4-benzoylphenoxy)acetyl]-methylamino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 9076521 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-[[2-(4-benzoylphenoxy)acetyl]-methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(C)C(=O)COc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N2O5/c1-23(14-19(24)22-12-13-27-2)20(25)15-28-18-10-8-17(9-11-18)21(26)16-6-4-3-5-7-16/h3-11H,12-15H2,1-2H3,(H,22,24) |
| InChIKey | NEOACFKYDSVSRA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|