C36H49N7O5 — CID 90767915
(2R)-N-[(2S)-1-[(tert-butylcarbamoylamino)-(cyclohexylmethyl)amino]-4-phenylbutan-2-yl]-2-hydroxy-2-(quinoline-2-carbonylamino)butanediamide (PubChem CID 90767915) has the molecular formula C36H49N7O5 and a molecular weight of 659.83 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-[(tert-butylcarbamoylamino)-(cyclohexylmethyl)amino]-4-phenylbutan-2-yl]-2-hydroxy-2-(quinoline-2-carbonylamino)butanediamide.
| Compound Name | (2R)-N-[(2S)-1-[(tert-butylcarbamoylamino)-(cyclohexylmethyl)amino]-4-phenylbutan-2-yl]-2-hydroxy-2-(quinoline-2-carbonylamino)butanediamide |
|---|---|
| PubChem CID | 90767915 |
| Molecular Formula | C36H49N7O5 |
| Molecular Weight | 659.83 g/mol |
| Exact Mass | 659.38 |
| IUPAC Name | (2R)-N-[(2S)-1-[(tert-butylcarbamoylamino)-(cyclohexylmethyl)amino]-4-phenylbutan-2-yl]-2-hydroxy-2-(quinoline-2-carbonylamino)butanediamide |
| SMILES | CC(C)(C)NC(=O)NN(CC1CCCCC1)C[C@H](CCc1ccccc1)NC(=O)[C@](O)(CC(N)=O)NC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C36H49N7O5/c1-35(2,3)41-34(47)42-43(23-26-14-8-5-9-15-26)24-28(20-18-25-12-6-4-7-13-25)38-33(46)36(48,22-31(37)44)40-32(45)30-21-19-27-16-10-11-17-29(27)39-30/h4,6-7,10-13,16-17,19,21,26,28,48H,5,8-9,14-15,18,20,22-24H2,1-3H3,(H2,37,44)(H,38,46)(H,40,45)(H2,41,42,47)/t28-,36+/m0/s1 |
| InChIKey | XDWUVEWRGKGYIJ-CZZIKKGSSA-N |
| XLogP | 3.54 |
| TPSA | 178.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.83 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|