C13H11N3O2 — CID 90768018
N-(7-oxocyclohepta-1,3,5-trien-1-yl)pyridine-4-carbohydrazide (PubChem CID 90768018) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is N-(7-oxocyclohepta-1,3,5-trien-1-yl)pyridine-4-carbohydrazide.
| Compound Name | N-(7-oxocyclohepta-1,3,5-trien-1-yl)pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 90768018 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-(7-oxocyclohepta-1,3,5-trien-1-yl)pyridine-4-carbohydrazide |
| SMILES | NN(C(=O)c1ccncc1)c1cccccc1=O |
| InChI | InChI=1S/C13H11N3O2/c14-16(11-4-2-1-3-5-12(11)17)13(18)10-6-8-15-9-7-10/h1-9H,14H2 |
| InChIKey | PJTMDCYCDJQISY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|