C20H33IO3 — CID 90768671
6-iodo-5-oxoicosa-3,6-dienoic acid (PubChem CID 90768671) has the molecular formula C20H33IO3 and a molecular weight of 448.39 g/mol. Its IUPAC name is 6-iodo-5-oxoicosa-3,6-dienoic acid.
| Compound Name | 6-iodo-5-oxoicosa-3,6-dienoic acid |
|---|---|
| PubChem CID | 90768671 |
| Molecular Formula | C20H33IO3 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 6-iodo-5-oxoicosa-3,6-dienoic acid |
| SMILES | CCCCCCCCCCCCCC=C(I)C(=O)C=CCC(=O)O |
| InChI | InChI=1S/C20H33IO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18(21)19(22)16-14-17-20(23)24/h14-16H,2-13,17H2,1H3,(H,23,24) |
| InChIKey | CJQOVULLPGDTEP-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|