C10H9NO4S2 — CID 90772556
4-hydroxy-5-(4-methoxyphenyl)sulfinyl-3H-1,3-thiazol-2-one (PubChem CID 90772556) has the molecular formula C10H9NO4S2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-hydroxy-5-(4-methoxyphenyl)sulfinyl-3H-1,3-thiazol-2-one.
| Compound Name | 4-hydroxy-5-(4-methoxyphenyl)sulfinyl-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 90772556 |
| Molecular Formula | C10H9NO4S2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 4-hydroxy-5-(4-methoxyphenyl)sulfinyl-3H-1,3-thiazol-2-one |
| SMILES | COc1ccc(S(=O)c2sc(=O)[nH]c2O)cc1 |
| InChI | InChI=1S/C10H9NO4S2/c1-15-6-2-4-7(5-3-6)17(14)9-8(12)11-10(13)16-9/h2-5,12H,1H3,(H,11,13) |
| InChIKey | NITMUQRYRFZPJE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |