C19H21N3O2 — CID 90773251
4-[6-(2-phenylethyl)pyrimidin-4-yl]-1-propan-2-ylpyrrolidine-2,3-dione (PubChem CID 90773251) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 4-[6-(2-phenylethyl)pyrimidin-4-yl]-1-propan-2-ylpyrrolidine-2,3-dione.
| Compound Name | 4-[6-(2-phenylethyl)pyrimidin-4-yl]-1-propan-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 90773251 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 4-[6-(2-phenylethyl)pyrimidin-4-yl]-1-propan-2-ylpyrrolidine-2,3-dione |
| SMILES | CC(C)N1CC(c2cc(CCc3ccccc3)ncn2)C(=O)C1=O |
| InChI | InChI=1S/C19H21N3O2/c1-13(2)22-11-16(18(23)19(22)24)17-10-15(20-12-21-17)9-8-14-6-4-3-5-7-14/h3-7,10,12-13,16H,8-9,11H2,1-2H3 |
| InChIKey | VXWCCBFSTJCFIV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|