C17H19Cl2NO2 — CID 71324814
3,4-dichloro-1-(5-methyl-1-phenylhexan-3-yl)pyrrole-2,5-dione (PubChem CID 71324814) has the molecular formula C17H19Cl2NO2 and a molecular weight of 340.25 g/mol. Its IUPAC name is 3,4-dichloro-1-(5-methyl-1-phenylhexan-3-yl)pyrrole-2,5-dione.
| Compound Name | 3,4-dichloro-1-(5-methyl-1-phenylhexan-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 71324814 |
| Molecular Formula | C17H19Cl2NO2 |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 3,4-dichloro-1-(5-methyl-1-phenylhexan-3-yl)pyrrole-2,5-dione |
| SMILES | CC(C)CC(CCc1ccccc1)N1C(=O)C(Cl)=C(Cl)C1=O |
| InChI | InChI=1S/C17H19Cl2NO2/c1-11(2)10-13(9-8-12-6-4-3-5-7-12)20-16(21)14(18)15(19)17(20)22/h3-7,11,13H,8-10H2,1-2H3 |
| InChIKey | CMUGBXCQYDCGDJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|