C13H24O3S2 — CID 90773303
2-[3-methyl-3-[2-methyl-2-(2-oxoethylsulfanyl)propoxy]butyl]sulfanylacetaldehyde (PubChem CID 90773303) has the molecular formula C13H24O3S2 and a molecular weight of 292.47 g/mol. Its IUPAC name is 2-[3-methyl-3-[2-methyl-2-(2-oxoethylsulfanyl)propoxy]butyl]sulfanylacetaldehyde.
| Compound Name | 2-[3-methyl-3-[2-methyl-2-(2-oxoethylsulfanyl)propoxy]butyl]sulfanylacetaldehyde |
|---|---|
| PubChem CID | 90773303 |
| Molecular Formula | C13H24O3S2 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-[3-methyl-3-[2-methyl-2-(2-oxoethylsulfanyl)propoxy]butyl]sulfanylacetaldehyde |
| SMILES | CC(C)(CCSCC=O)OCC(C)(C)SCC=O |
| InChI | InChI=1S/C13H24O3S2/c1-12(2,5-8-17-9-6-14)16-11-13(3,4)18-10-7-15/h6-7H,5,8-11H2,1-4H3 |
| InChIKey | BPFVCGJSNDUVCO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|