C13H26O2S — CID 90785593
2-[3-(3,3-dimethylbutoxy)-3-methylbutyl]sulfanylacetaldehyde (PubChem CID 90785593) has the molecular formula C13H26O2S and a molecular weight of 246.42 g/mol. Its IUPAC name is 2-[3-(3,3-dimethylbutoxy)-3-methylbutyl]sulfanylacetaldehyde.
| Compound Name | 2-[3-(3,3-dimethylbutoxy)-3-methylbutyl]sulfanylacetaldehyde |
|---|---|
| PubChem CID | 90785593 |
| Molecular Formula | C13H26O2S |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2-[3-(3,3-dimethylbutoxy)-3-methylbutyl]sulfanylacetaldehyde |
| SMILES | CC(C)(C)CCOC(C)(C)CCSCC=O |
| InChI | InChI=1S/C13H26O2S/c1-12(2,3)6-9-15-13(4,5)7-10-16-11-8-14/h8H,6-7,9-11H2,1-5H3 |
| InChIKey | OSQHWKRDFZJEMO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|